C24H32O5S — CID 54245334
3-(2-carboxyethylsulfanyl)-3-[3-(8-phenyloctyl)furan-2-yl]propanoic acid (PubChem CID 54245334) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is 3-(2-carboxyethylsulfanyl)-3-[3-(8-phenyloctyl)furan-2-yl]propanoic acid.
| Compound Name | 3-(2-carboxyethylsulfanyl)-3-[3-(8-phenyloctyl)furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54245334 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-(2-carboxyethylsulfanyl)-3-[3-(8-phenyloctyl)furan-2-yl]propanoic acid |
| SMILES | O=C(O)CCSC(CC(=O)O)c1occc1CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C24H32O5S/c25-22(26)15-17-30-21(18-23(27)28)24-20(14-16-29-24)13-9-4-2-1-3-6-10-19-11-7-5-8-12-19/h5,7-8,11-12,14,16,21H,1-4,6,9-10,13,15,17-18H2,(H,25,26)(H,27,28) |
| InChIKey | QSWYPUNVWOLIEC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|