C24H22ClNO — CID 54246721
1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine (PubChem CID 54246721) has the molecular formula C24H22ClNO and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine.
| Compound Name | 1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
|---|---|
| PubChem CID | 54246721 |
| Molecular Formula | C24H22ClNO |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
| SMILES | Cc1c(CONC(=C2CC2)c2ccc(Cl)cc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C24H22ClNO/c1-17-21(8-5-9-23(17)18-6-3-2-4-7-18)16-27-26-24(19-10-11-19)20-12-14-22(25)15-13-20/h2-9,12-15,26H,10-11,16H2,1H3 |
| InChIKey | QTTWZJGPFWKALR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|