C10H17Cl2NO3 — CID 54249446
2,2-dichloro-N-(diethoxymethyl)-N-prop-2-enylacetamide (PubChem CID 54249446) has the molecular formula C10H17Cl2NO3 and a molecular weight of 270.16 g/mol. Its IUPAC name is 2,2-dichloro-N-(diethoxymethyl)-N-prop-2-enylacetamide.
| Compound Name | 2,2-dichloro-N-(diethoxymethyl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 54249446 |
| Molecular Formula | C10H17Cl2NO3 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2,2-dichloro-N-(diethoxymethyl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)C(Cl)Cl)C(OCC)OCC |
| InChI | InChI=1S/C10H17Cl2NO3/c1-4-7-13(9(14)8(11)12)10(15-5-2)16-6-3/h4,8,10H,1,5-7H2,2-3H3 |
| InChIKey | QVSJNJIHMYMQNY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|