C20H32N4O4S — CID 54250161
1-N-(2-methoxyethyl)-2-nitro-1-N'-[2-[[5-[(3-tricyclo[2.2.1.02,6]heptanylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]ethane-1,1-diamine (PubChem CID 54250161) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-N-(2-methoxyethyl)-2-nitro-1-N'-[2-[[5-[(3-tricyclo[2.2.1.02,6]heptanylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]ethane-1,1-diamine.
| Compound Name | 1-N-(2-methoxyethyl)-2-nitro-1-N'-[2-[[5-[(3-tricyclo[2.2.1.02,6]heptanylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 54250161 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 1-N-(2-methoxyethyl)-2-nitro-1-N'-[2-[[5-[(3-tricyclo[2.2.1.02,6]heptanylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]ethane-1,1-diamine |
| SMILES | COCCNC(C[N+](=O)[O-])NCCSCc1ccc(CNC2C3CC4C(C3)C42)o1 |
| InChI | InChI=1S/C20H32N4O4S/c1-27-6-4-21-18(11-24(25)26)22-5-7-29-12-15-3-2-14(28-15)10-23-20-13-8-16-17(9-13)19(16)20/h2-3,13,16-23H,4-12H2,1H3 |
| InChIKey | QWEOJDYKWFWGQI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|