C11H10ClFN4S — CID 54253493
3-[(7-amino-4-chloro-6-fluoro-1,3-benzothiazol-2-yl)-methylamino]propanenitrile (PubChem CID 54253493) has the molecular formula C11H10ClFN4S and a molecular weight of 284.75 g/mol. Its IUPAC name is 3-[(7-amino-4-chloro-6-fluoro-1,3-benzothiazol-2-yl)-methylamino]propanenitrile.
| Compound Name | 3-[(7-amino-4-chloro-6-fluoro-1,3-benzothiazol-2-yl)-methylamino]propanenitrile |
|---|---|
| PubChem CID | 54253493 |
| Molecular Formula | C11H10ClFN4S |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 3-[(7-amino-4-chloro-6-fluoro-1,3-benzothiazol-2-yl)-methylamino]propanenitrile |
| SMILES | CN(CCC#N)c1nc2c(Cl)cc(F)c(N)c2s1 |
| InChI | InChI=1S/C11H10ClFN4S/c1-17(4-2-3-14)11-16-9-6(12)5-7(13)8(15)10(9)18-11/h5H,2,4,15H2,1H3 |
| InChIKey | QYKCPARCBCXYBB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|