C12H9ClFN3OS — CID 11808638
4-chloro-6-fluoro-7-isocyanato-2-pyrrolidin-1-yl-1,3-benzothiazole (PubChem CID 11808638) has the molecular formula C12H9ClFN3OS and a molecular weight of 297.74 g/mol. Its IUPAC name is 4-chloro-6-fluoro-7-isocyanato-2-pyrrolidin-1-yl-1,3-benzothiazole.
| Compound Name | 4-chloro-6-fluoro-7-isocyanato-2-pyrrolidin-1-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 11808638 |
| Molecular Formula | C12H9ClFN3OS |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 4-chloro-6-fluoro-7-isocyanato-2-pyrrolidin-1-yl-1,3-benzothiazole |
| SMILES | O=C=Nc1c(F)cc(Cl)c2nc(N3CCCC3)sc12 |
| InChI | InChI=1S/C12H9ClFN3OS/c13-7-5-8(14)10(15-6-18)11-9(7)16-12(19-11)17-3-1-2-4-17/h5H,1-4H2 |
| InChIKey | TVWNISUHOINUNC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|