C11H10Cl2N2S — CID 3238733
4,7-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole (PubChem CID 3238733) has the molecular formula C11H10Cl2N2S and a molecular weight of 273.19 g/mol. Its IUPAC name is 4,7-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole.
| Compound Name | 4,7-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 3238733 |
| Molecular Formula | C11H10Cl2N2S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 4,7-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole |
| SMILES | Clc1ccc(Cl)c2sc(N3CCCC3)nc12 |
| InChI | InChI=1S/C11H10Cl2N2S/c12-7-3-4-8(13)10-9(7)14-11(16-10)15-5-1-2-6-15/h3-4H,1-2,5-6H2 |
| InChIKey | VKVXVSZEJHGECF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |