C19H26F2O2 — CID 54255138
1-[2-(4-butoxycyclohexyl)ethenyl]-4-(difluoromethoxy)benzene (PubChem CID 54255138) has the molecular formula C19H26F2O2 and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[2-(4-butoxycyclohexyl)ethenyl]-4-(difluoromethoxy)benzene.
| Compound Name | 1-[2-(4-butoxycyclohexyl)ethenyl]-4-(difluoromethoxy)benzene |
|---|---|
| PubChem CID | 54255138 |
| Molecular Formula | C19H26F2O2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-[2-(4-butoxycyclohexyl)ethenyl]-4-(difluoromethoxy)benzene |
| SMILES | CCCCOC1CCC(C=Cc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H26F2O2/c1-2-3-14-22-17-10-6-15(7-11-17)4-5-16-8-12-18(13-9-16)23-19(20)21/h4-5,8-9,12-13,15,17,19H,2-3,6-7,10-11,14H2,1H3 |
| InChIKey | QZMQBHZXFCLYSL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|