C33H44O3 — CID 20717280
(4-propylphenyl) 4-[(E)-2-[4-(4-propoxycyclohexyl)cyclohexyl]ethenyl]benzoate (PubChem CID 20717280) has the molecular formula C33H44O3 and a molecular weight of 488.71 g/mol. Its IUPAC name is (4-propylphenyl) 4-[(E)-2-[4-(4-propoxycyclohexyl)cyclohexyl]ethenyl]benzoate.
| Compound Name | (4-propylphenyl) 4-[(E)-2-[4-(4-propoxycyclohexyl)cyclohexyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 20717280 |
| Molecular Formula | C33H44O3 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | (4-propylphenyl) 4-[(E)-2-[4-(4-propoxycyclohexyl)cyclohexyl]ethenyl]benzoate |
| SMILES | CCCOC1CCC(C2CCC(/C=C/c3ccc(C(=O)Oc4ccc(CCC)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C33H44O3/c1-3-5-25-12-20-32(21-13-25)36-33(34)30-16-10-27(11-17-30)7-6-26-8-14-28(15-9-26)29-18-22-31(23-19-29)35-24-4-2/h6-7,10-13,16-17,20-21,26,28-29,31H,3-5,8-9,14-15,18-19,22-24H2,1-2H3/b7-6+ |
| InChIKey | IOMZOGBOFHLFSB-VOTSOKGWSA-N |
| XLogP | 8.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|