About tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid
tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid (PubChem CID 54255571) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid.
Analyze tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid?
The IUPAC name of tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid (CID 54255571) is tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid.
What is the SMILES notation for tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid?
The canonical SMILES for tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid is O=C(O)c1cc2c3ccccc3c1CC2.
What is the InChIKey of tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid?
The InChIKey is QZURYBYBFVUUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c14-13(15)12-7-8-5-6-11(12)10-4-2-1-3-9(8)10/h1-4,7H,5-6H2,(H,14,15).
What are the key properties of tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid?
tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid has a molecular weight of 198.22 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8-pentaene-9-carboxylic acid is sourced from PubChem (CID 54255571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).