C27H36N6O9 — CID 54255712
(2R)-1-[(2S)-1-[(2S)-2-[[(2S)-2-(methoxyamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)-3,6-dioxo-2-propan-2-ylpiperidine-2-carboxamide (PubChem CID 54255712) has the molecular formula C27H36N6O9 and a molecular weight of 588.62 g/mol. Its IUPAC name is (2R)-1-[(2S)-1-[(2S)-2-[[(2S)-2-(methoxyamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)-3,6-dioxo-2-propan-2-ylpiperidine-2-carboxamide.
| Compound Name | (2R)-1-[(2S)-1-[(2S)-2-[[(2S)-2-(methoxyamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)-3,6-dioxo-2-propan-2-ylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 54255712 |
| Molecular Formula | C27H36N6O9 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | (2R)-1-[(2S)-1-[(2S)-2-[[(2S)-2-(methoxyamino)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)-3,6-dioxo-2-propan-2-ylpiperidine-2-carboxamide |
| SMILES | CON[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N1C(=O)CCC(=O)[C@@]1(C(=O)Nc1ccc([N+](=O)[O-])cc1)C(C)C |
| InChI | InChI=1S/C27H36N6O9/c1-15(2)27(26(39)29-18-8-10-19(11-9-18)33(40)41)21(34)12-13-22(35)32(27)25(38)20-7-6-14-31(20)24(37)17(4)28-23(36)16(3)30-42-5/h8-11,15-17,20,30H,6-7,12-14H2,1-5H3,(H,28,36)(H,29,39)/t16-,17-,20-,27+/m0/s1 |
| InChIKey | QZXQJYPGCRPZIX-ZMLWSTMWSA-N |
| XLogP | 0.68 |
| TPSA | 197.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|