C23H33N3O — CID 54258146
N-[2-[1-[4-cyano-4-(3-methylphenyl)cyclohexyl]pyrrolidin-3-yl]propan-2-yl]acetamide (PubChem CID 54258146) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is N-[2-[1-[4-cyano-4-(3-methylphenyl)cyclohexyl]pyrrolidin-3-yl]propan-2-yl]acetamide.
| Compound Name | N-[2-[1-[4-cyano-4-(3-methylphenyl)cyclohexyl]pyrrolidin-3-yl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 54258146 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | N-[2-[1-[4-cyano-4-(3-methylphenyl)cyclohexyl]pyrrolidin-3-yl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)C1CCN(C2CCC(C#N)(c3cccc(C)c3)CC2)C1 |
| InChI | InChI=1S/C23H33N3O/c1-17-6-5-7-19(14-17)23(16-24)11-8-21(9-12-23)26-13-10-20(15-26)22(3,4)25-18(2)27/h5-7,14,20-21H,8-13,15H2,1-4H3,(H,25,27) |
| InChIKey | RBNJUCKMLVRFED-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |