C32H32N2O2 — CID 54258313
N-[4-methyl-5-[(3-phenoxyphenyl)methylideneamino]pentyl]-1-(3-phenoxyphenyl)methanimine (PubChem CID 54258313) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[4-methyl-5-[(3-phenoxyphenyl)methylideneamino]pentyl]-1-(3-phenoxyphenyl)methanimine.
| Compound Name | N-[4-methyl-5-[(3-phenoxyphenyl)methylideneamino]pentyl]-1-(3-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 54258313 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-[4-methyl-5-[(3-phenoxyphenyl)methylideneamino]pentyl]-1-(3-phenoxyphenyl)methanimine |
| SMILES | CC(CCC/N=C/c1cccc(Oc2ccccc2)c1)C/N=C/c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C32H32N2O2/c1-26(23-34-25-28-13-9-19-32(22-28)36-30-16-6-3-7-17-30)11-10-20-33-24-27-12-8-18-31(21-27)35-29-14-4-2-5-15-29/h2-9,12-19,21-22,24-26H,10-11,20,23H2,1H3/b33-24+,34-25+ |
| InChIKey | RBQBIRWZWINYPG-WASGUHIUSA-N |
| XLogP | 8.23 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|