C10H13FO4S — CID 54260380
3-(4-fluorophenoxy)butane-1-sulfonic acid (PubChem CID 54260380) has the molecular formula C10H13FO4S and a molecular weight of 248.27 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)butane-1-sulfonic acid.
| Compound Name | 3-(4-fluorophenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 54260380 |
| Molecular Formula | C10H13FO4S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-(4-fluorophenoxy)butane-1-sulfonic acid |
| SMILES | CC(CCS(=O)(=O)O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C10H13FO4S/c1-8(6-7-16(12,13)14)15-10-4-2-9(11)3-5-10/h2-5,8H,6-7H2,1H3,(H,12,13,14) |
| InChIKey | RDBNHRSYICZXHJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|