C13H14N4O2 — CID 54263108
3-(3-acetamido-2,5-dimethylphenyl)prop-2-enoyl azide (PubChem CID 54263108) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-(3-acetamido-2,5-dimethylphenyl)prop-2-enoyl azide.
| Compound Name | 3-(3-acetamido-2,5-dimethylphenyl)prop-2-enoyl azide |
|---|---|
| PubChem CID | 54263108 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-(3-acetamido-2,5-dimethylphenyl)prop-2-enoyl azide |
| SMILES | CC(=O)Nc1cc(C)cc(C=CC(=O)N=[N+]=[N-])c1C |
| InChI | InChI=1S/C13H14N4O2/c1-8-6-11(4-5-13(19)16-17-14)9(2)12(7-8)15-10(3)18/h4-7H,1-3H3,(H,15,18) |
| InChIKey | REWUCFGVNYBHMS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|