C20H17N3O4 — CID 44576665
(E)-3-(3,6,7-trimethoxyphenanthren-9-yl)prop-2-enoyl azide (PubChem CID 44576665) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is (E)-3-(3,6,7-trimethoxyphenanthren-9-yl)prop-2-enoyl azide.
| Compound Name | (E)-3-(3,6,7-trimethoxyphenanthren-9-yl)prop-2-enoyl azide |
|---|---|
| PubChem CID | 44576665 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (E)-3-(3,6,7-trimethoxyphenanthren-9-yl)prop-2-enoyl azide |
| SMILES | COc1ccc2cc(/C=C/C(=O)N=[N+]=[N-])c3cc(OC)c(OC)cc3c2c1 |
| InChI | InChI=1S/C20H17N3O4/c1-25-14-6-4-12-8-13(5-7-20(24)22-23-21)16-10-18(26-2)19(27-3)11-17(16)15(12)9-14/h4-11H,1-3H3/b7-5+ |
| InChIKey | BNWWDWAESHQYGI-FNORWQNLSA-N |
| XLogP | 4.87 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|