About 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene
10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene (PubChem CID 16731953) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene.
Molecular Properties
| Compound Name | 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene |
| PubChem CID | 16731953 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene |
| SMILES | COc1ccc2cc(/C=C\CCCN=[N+]=[N-])c3cc(OC)c(OC)cc3c2c1 |
| InChI | InChI=1S/C22H23N3O3/c1-26-17-9-8-16-11-15(7-5-4-6-10-24-25-23)19-13-21(27-2)22(28-3)14-20(19)18(16)12-17/h5,7-9,11-14H,4,6,10H2,1-3H3/b7-5- |
| InChIKey | ZYFOKNFOJXJQEK-ALCCZGGFSA-N |
| XLogP | 6.12 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene?
The IUPAC name of 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene (CID 16731953) is 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene.
What is the SMILES notation for 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene?
The canonical SMILES for 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene is COc1ccc2cc(/C=C\CCCN=[N+]=[N-])c3cc(OC)c(OC)cc3c2c1.
What is the InChIKey of 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene?
The InChIKey is ZYFOKNFOJXJQEK-ALCCZGGFSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-26-17-9-8-16-11-15(7-5-4-6-10-24-25-23)19-13-21(27-2)22(28-3)14-20(19)18(16)12-17/h5,7-9,11-14H,4,6,10H2,1-3H3/b7-5-.
What are the key properties of 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene?
10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene has a molecular weight of 377.44 g/mol, XLogP of 6.12, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[(Z)-5-azidopent-1-enyl]-2,3,6-trimethoxyphenanthrene is sourced from PubChem (CID 16731953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).