C16H9ClN4O2 — CID 54266310
5-chloro-2-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]-1-benzofuran-3-one (PubChem CID 54266310) has the molecular formula C16H9ClN4O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is 5-chloro-2-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]-1-benzofuran-3-one.
| Compound Name | 5-chloro-2-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 54266310 |
| Molecular Formula | C16H9ClN4O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 5-chloro-2-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccc(-c3nn[nH]n3)cc2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H9ClN4O2/c17-11-5-6-13-12(8-11)15(22)14(23-13)7-9-1-3-10(4-2-9)16-18-20-21-19-16/h1-8H,(H,18,19,20,21) |
| InChIKey | RGZUHTFUQNMMHV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|