C24H30N2O4 — CID 54267657
4-(1,3-benzodioxol-5-yl)-N-[3-[2-(3-methoxyphenyl)ethyl-methylamino]propyl]but-3-enamide (PubChem CID 54267657) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-[3-[2-(3-methoxyphenyl)ethyl-methylamino]propyl]but-3-enamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-[3-[2-(3-methoxyphenyl)ethyl-methylamino]propyl]but-3-enamide |
|---|---|
| PubChem CID | 54267657 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-[3-[2-(3-methoxyphenyl)ethyl-methylamino]propyl]but-3-enamide |
| SMILES | COc1cccc(CCN(C)CCCNC(=O)CC=Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-26(15-12-20-6-3-8-21(16-20)28-2)14-5-13-25-24(27)9-4-7-19-10-11-22-23(17-19)30-18-29-22/h3-4,6-8,10-11,16-17H,5,9,12-15,18H2,1-2H3,(H,25,27) |
| InChIKey | RHWRYFSIJKLNIE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|