C25H31N3O3 — CID 54015786
4-(2-cyanophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide (PubChem CID 54015786) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-(2-cyanophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide.
| Compound Name | 4-(2-cyanophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide |
|---|---|
| PubChem CID | 54015786 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-(2-cyanophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide |
| SMILES | COc1ccc(CCN(C)CCCNC(=O)CC=Cc2ccccc2C#N)cc1OC |
| InChI | InChI=1S/C25H31N3O3/c1-28(17-14-20-12-13-23(30-2)24(18-20)31-3)16-7-15-27-25(29)11-6-10-21-8-4-5-9-22(21)19-26/h4-6,8-10,12-13,18H,7,11,14-17H2,1-3H3,(H,27,29) |
| InChIKey | KVNKAXDYVMZLPK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|