C29H35N3O4 — CID 54089694
N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(2-oxo-1-pyridinyl)phenyl]but-3-enamide (PubChem CID 54089694) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(2-oxo-1-pyridinyl)phenyl]but-3-enamide.
| Compound Name | N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(2-oxo-1-pyridinyl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 54089694 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(2-oxo-1-pyridinyl)phenyl]but-3-enamide |
| SMILES | COc1ccc(CCN(C)CCCNC(=O)CC=Cc2ccc(-n3ccccc3=O)cc2)cc1OC |
| InChI | InChI=1S/C29H35N3O4/c1-31(21-17-24-13-16-26(35-2)27(22-24)36-3)19-7-18-30-28(33)9-6-8-23-11-14-25(15-12-23)32-20-5-4-10-29(32)34/h4-6,8,10-16,20,22H,7,9,17-19,21H2,1-3H3,(H,30,33) |
| InChIKey | MSYZXJWQGQGLLP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|