C26H35N3O4 — CID 10456590
(E)-4-(4-acetamidophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide (PubChem CID 10456590) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is (E)-4-(4-acetamidophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide.
| Compound Name | (E)-4-(4-acetamidophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide |
|---|---|
| PubChem CID | 10456590 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | (E)-4-(4-acetamidophenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]but-3-enamide |
| SMILES | COc1ccc(CCN(C)CCCNC(=O)C/C=C/c2ccc(NC(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C26H35N3O4/c1-20(30)28-23-12-9-21(10-13-23)7-5-8-26(31)27-16-6-17-29(2)18-15-22-11-14-24(32-3)25(19-22)33-4/h5,7,9-14,19H,6,8,15-18H2,1-4H3,(H,27,31)(H,28,30)/b7-5+ |
| InChIKey | HWLAWFUILIBJQN-FNORWQNLSA-N |
| XLogP | 3.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|