C28H36N4O3 — CID 15045376
(E)-N-[3-[1-(3,4-dimethoxyphenyl)propan-2-yl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide (PubChem CID 15045376) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is (E)-N-[3-[1-(3,4-dimethoxyphenyl)propan-2-yl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide.
| Compound Name | (E)-N-[3-[1-(3,4-dimethoxyphenyl)propan-2-yl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide |
|---|---|
| PubChem CID | 15045376 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (E)-N-[3-[1-(3,4-dimethoxyphenyl)propan-2-yl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide |
| SMILES | COc1ccc(CC(C)N(C)CCCNC(=O)C/C=C/c2ccc(-n3ccnc3)cc2)cc1OC |
| InChI | InChI=1S/C28H36N4O3/c1-22(19-24-11-14-26(34-3)27(20-24)35-4)31(2)17-6-15-30-28(33)8-5-7-23-9-12-25(13-10-23)32-18-16-29-21-32/h5,7,9-14,16,18,20-22H,6,8,15,17,19H2,1-4H3,(H,30,33)/b7-5+ |
| InChIKey | GKPVZKOQJDWGLQ-FNORWQNLSA-N |
| XLogP | 4.36 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|