C26H31N5O3 — CID 67785844
(E)-4-(4-imidazol-1-ylphenyl)-N-[4-[methyl-[2-(4-nitrophenyl)ethyl]amino]butyl]but-3-enamide (PubChem CID 67785844) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is (E)-4-(4-imidazol-1-ylphenyl)-N-[4-[methyl-[2-(4-nitrophenyl)ethyl]amino]butyl]but-3-enamide.
| Compound Name | (E)-4-(4-imidazol-1-ylphenyl)-N-[4-[methyl-[2-(4-nitrophenyl)ethyl]amino]butyl]but-3-enamide |
|---|---|
| PubChem CID | 67785844 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (E)-4-(4-imidazol-1-ylphenyl)-N-[4-[methyl-[2-(4-nitrophenyl)ethyl]amino]butyl]but-3-enamide |
| SMILES | CN(CCCCNC(=O)C/C=C/c1ccc(-n2ccnc2)cc1)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H31N5O3/c1-29(19-15-23-9-13-25(14-10-23)31(33)34)18-3-2-16-28-26(32)6-4-5-22-7-11-24(12-8-22)30-20-17-27-21-30/h4-5,7-14,17,20-21H,2-3,6,15-16,18-19H2,1H3,(H,28,32)/b5-4+ |
| InChIKey | QSMGTWGATMIGQM-SNAWJCMRSA-N |
| XLogP | 4.25 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|