C27H34N4O3 — CID 15045289
(E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide (PubChem CID 15045289) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is (E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide.
| Compound Name | (E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide |
|---|---|
| PubChem CID | 15045289 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(4-imidazol-1-ylphenyl)but-3-enamide |
| SMILES | COc1ccc(CCN(C)CCCNC(=O)C/C=C/c2ccc(-n3ccnc3)cc2)cc1OC |
| InChI | InChI=1S/C27H34N4O3/c1-30(18-14-23-10-13-25(33-2)26(20-23)34-3)17-5-15-29-27(32)7-4-6-22-8-11-24(12-9-22)31-19-16-28-21-31/h4,6,8-13,16,19-21H,5,7,14-15,17-18H2,1-3H3,(H,29,32)/b6-4+ |
| InChIKey | JBDXHRQIJSPHDE-GQCTYLIASA-N |
| XLogP | 3.97 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|