C26H37N3O3 — CID 10433329
(E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(dimethylamino)phenyl]but-3-enamide (PubChem CID 10433329) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is (E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(dimethylamino)phenyl]but-3-enamide.
| Compound Name | (E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(dimethylamino)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 10433329 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | (E)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-[4-(dimethylamino)phenyl]but-3-enamide |
| SMILES | COc1ccc(CCN(C)CCCNC(=O)C/C=C/c2ccc(N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C26H37N3O3/c1-28(2)23-13-10-21(11-14-23)8-6-9-26(30)27-17-7-18-29(3)19-16-22-12-15-24(31-4)25(20-22)32-5/h6,8,10-15,20H,7,9,16-19H2,1-5H3,(H,27,30)/b8-6+ |
| InChIKey | ZHWBOHIBXPIFJE-SOFGYWHQSA-N |
| XLogP | 3.85 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|