C21H21NO4S — CID 54268024
1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-4-naphthalen-1-yl-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 54268024) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-4-naphthalen-1-yl-2,5-dihydropyrrole-2-carboxylic acid.
| Compound Name | 1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-4-naphthalen-1-yl-2,5-dihydropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 54268024 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-4-naphthalen-1-yl-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | CC(=O)SC[C@@H](C)C(=O)N1CC(c2cccc3ccccc23)=CC1C(=O)O |
| InChI | InChI=1S/C21H21NO4S/c1-13(12-27-14(2)23)20(24)22-11-16(10-19(22)21(25)26)18-9-5-7-15-6-3-4-8-17(15)18/h3-10,13,19H,11-12H2,1-2H3,(H,25,26)/t13-,19?/m1/s1 |
| InChIKey | RIDDHALGQZUQHQ-BSOCMFCZSA-N |
| XLogP | 3.43 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|