C19H26O — CID 54270900
1-[(1R,2R,5S)-2,3,4-trimethyl-5-(2,3,6-trimethylphenyl)cyclopent-3-en-1-yl]ethanone (PubChem CID 54270900) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[(1R,2R,5S)-2,3,4-trimethyl-5-(2,3,6-trimethylphenyl)cyclopent-3-en-1-yl]ethanone.
| Compound Name | 1-[(1R,2R,5S)-2,3,4-trimethyl-5-(2,3,6-trimethylphenyl)cyclopent-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 54270900 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-[(1R,2R,5S)-2,3,4-trimethyl-5-(2,3,6-trimethylphenyl)cyclopent-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@@H](C)C(C)=C(C)[C@H]1c1c(C)ccc(C)c1C |
| InChI | InChI=1S/C19H26O/c1-10-8-9-11(2)17(12(10)3)19-15(6)13(4)14(5)18(19)16(7)20/h8-9,14,18-19H,1-7H3/t14-,18-,19-/m0/s1 |
| InChIKey | RKAWBQNTUSZSMO-JVPBZIDWSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|