About 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate
2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate (PubChem CID 54270905) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate.
Molecular Properties
| Compound Name | 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate |
| PubChem CID | 54270905 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate |
| SMILES | CN(CCOC(=O)Oc1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO3/c1-23(20-10-6-3-7-11-20)16-17-25-22(24)26-21-14-12-19(13-15-21)18-8-4-2-5-9-18/h2-15H,16-17H2,1H3 |
| InChIKey | RKAXYFVLLUIJQY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate?
The IUPAC name of 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate (CID 54270905) is 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate.
What is the SMILES notation for 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate?
The canonical SMILES for 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate is CN(CCOC(=O)Oc1ccc(-c2ccccc2)cc1)c1ccccc1.
What is the InChIKey of 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate?
The InChIKey is RKAXYFVLLUIJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3/c1-23(20-10-6-3-7-11-20)16-17-25-22(24)26-21-14-12-19(13-15-21)18-8-4-2-5-9-18/h2-15H,16-17H2,1H3.
What are the key properties of 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate?
2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate has a molecular weight of 347.41 g/mol, XLogP of 5.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-methylanilino)ethyl (4-phenylphenyl) carbonate is sourced from PubChem (CID 54270905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).