C16H16ClN3O4 — CID 5427186
propan-2-yl 2-[5-[(Z)-(carbamoylhydrazinylidene)methyl]furan-2-yl]-4-chlorobenzoate (PubChem CID 5427186) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is propan-2-yl 2-[5-[(Z)-(carbamoylhydrazinylidene)methyl]furan-2-yl]-4-chlorobenzoate.
| Compound Name | propan-2-yl 2-[5-[(Z)-(carbamoylhydrazinylidene)methyl]furan-2-yl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 5427186 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | propan-2-yl 2-[5-[(Z)-(carbamoylhydrazinylidene)methyl]furan-2-yl]-4-chlorobenzoate |
| SMILES | CC(C)OC(=O)c1ccc(Cl)cc1-c1ccc(/C=N\NC(N)=O)o1 |
| InChI | InChI=1S/C16H16ClN3O4/c1-9(2)23-15(21)12-5-3-10(17)7-13(12)14-6-4-11(24-14)8-19-20-16(18)22/h3-9H,1-2H3,(H3,18,20,22)/b19-8- |
| InChIKey | DBLJGQPCGAXLAB-UWVJOHFNSA-N |
| XLogP | 3.17 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|