About 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one
1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one (PubChem CID 54276211) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one.
Analyze 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one?
The IUPAC name of 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one (CID 54276211) is 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one.
What is the SMILES notation for 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one?
The canonical SMILES for 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one is CC(=O)CC1=NCCCC1.
What is the InChIKey of 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one?
The InChIKey is RNPJYJWOONZRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-7(10)6-8-4-2-3-5-9-8/h2-6H2,1H3.
What are the key properties of 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one?
1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one has a molecular weight of 139.20 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3,4,5-tetrahydropyridin-6-yl)propan-2-one is sourced from PubChem (CID 54276211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).