C19H28NO3S+ — CID 54278061
carboxy-(2,2-dimethyl-3H-1-benzofuran-7-yl)-hept-3-enylsulfanyl-methylazanium (PubChem CID 54278061) has the molecular formula C19H28NO3S+ and a molecular weight of 350.50 g/mol. Its IUPAC name is carboxy-(2,2-dimethyl-3H-1-benzofuran-7-yl)-hept-3-enylsulfanyl-methylazanium.
| Compound Name | carboxy-(2,2-dimethyl-3H-1-benzofuran-7-yl)-hept-3-enylsulfanyl-methylazanium |
|---|---|
| PubChem CID | 54278061 |
| Molecular Formula | C19H28NO3S+ |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | carboxy-(2,2-dimethyl-3H-1-benzofuran-7-yl)-hept-3-enylsulfanyl-methylazanium |
| SMILES | CCCC=CCCS[N+](C)(C(=O)O)c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C19H27NO3S/c1-5-6-7-8-9-13-24-20(4,18(21)22)16-12-10-11-15-14-19(2,3)23-17(15)16/h7-8,10-12H,5-6,9,13-14H2,1-4H3/p+1 |
| InChIKey | LCICJOYAKODSEX-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|