C18H26N2O3S — CID 172745237
S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate (PubChem CID 172745237) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate.
| Compound Name | S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate |
|---|---|
| PubChem CID | 172745237 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate |
| SMILES | CCCCN(C)C(=O)SC(=O)N(C)c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C18H26N2O3S/c1-6-7-11-19(4)16(21)24-17(22)20(5)14-10-8-9-13-12-18(2,3)23-15(13)14/h8-10H,6-7,11-12H2,1-5H3 |
| InChIKey | JQAZDIITDJROHB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|