About S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate
S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate (PubChem CID 172745237) has the molecular formula C18H26N2O3S
and a molecular weight of 350.48 g/mol. Its IUPAC name is S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate.
Molecular Properties
| Compound Name | S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate |
| PubChem CID | 172745237 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate |
| SMILES | CCCCN(C)C(=O)SC(=O)N(C)c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C18H26N2O3S/c1-6-7-11-19(4)16(21)24-17(22)20(5)14-10-8-9-13-12-18(2,3)23-15(13)14/h8-10H,6-7,11-12H2,1-5H3 |
| InChIKey | JQAZDIITDJROHB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate?
The IUPAC name of S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate (CID 172745237) is S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate.
What is the SMILES notation for S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate?
The canonical SMILES for S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate is CCCCN(C)C(=O)SC(=O)N(C)c1cccc2c1OC(C)(C)C2.
What is the InChIKey of S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate?
The InChIKey is JQAZDIITDJROHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O3S/c1-6-7-11-19(4)16(21)24-17(22)20(5)14-10-8-9-13-12-18(2,3)23-15(13)14/h8-10H,6-7,11-12H2,1-5H3.
What are the key properties of S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate?
S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate has a molecular weight of 350.48 g/mol, XLogP of 4.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-methylcarbamoyl] N-butyl-N-methylcarbamothioate is sourced from PubChem (CID 172745237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).