C20H32N2O3S — CID 150420166
[butyl-[4-(2,2-dimethyl-3H-1-benzofuran-7-yl)butyl]amino]sulfanyl-methylcarbamic acid (PubChem CID 150420166) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is [butyl-[4-(2,2-dimethyl-3H-1-benzofuran-7-yl)butyl]amino]sulfanyl-methylcarbamic acid.
| Compound Name | [butyl-[4-(2,2-dimethyl-3H-1-benzofuran-7-yl)butyl]amino]sulfanyl-methylcarbamic acid |
|---|---|
| PubChem CID | 150420166 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [butyl-[4-(2,2-dimethyl-3H-1-benzofuran-7-yl)butyl]amino]sulfanyl-methylcarbamic acid |
| SMILES | CCCCN(CCCCc1cccc2c1OC(C)(C)C2)SN(C)C(=O)O |
| InChI | InChI=1S/C20H32N2O3S/c1-5-6-13-22(26-21(4)19(23)24)14-8-7-10-16-11-9-12-17-15-20(2,3)25-18(16)17/h9,11-12H,5-8,10,13-15H2,1-4H3,(H,23,24) |
| InChIKey | HHPJUPFYSPRRDT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|