C25H31ClN2O3 — CID 167960564
2-chloro-N-[4-[[2-(2,2-dimethyl-3H-1-benzofuran-7-yl)acetyl]-methylamino]butyl]-N-methylbenzamide (PubChem CID 167960564) has the molecular formula C25H31ClN2O3 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-chloro-N-[4-[[2-(2,2-dimethyl-3H-1-benzofuran-7-yl)acetyl]-methylamino]butyl]-N-methylbenzamide.
| Compound Name | 2-chloro-N-[4-[[2-(2,2-dimethyl-3H-1-benzofuran-7-yl)acetyl]-methylamino]butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 167960564 |
| Molecular Formula | C25H31ClN2O3 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-chloro-N-[4-[[2-(2,2-dimethyl-3H-1-benzofuran-7-yl)acetyl]-methylamino]butyl]-N-methylbenzamide |
| SMILES | CN(CCCCN(C)C(=O)c1ccccc1Cl)C(=O)Cc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C25H31ClN2O3/c1-25(2)17-19-11-9-10-18(23(19)31-25)16-22(29)27(3)14-7-8-15-28(4)24(30)20-12-5-6-13-21(20)26/h5-6,9-13H,7-8,14-17H2,1-4H3 |
| InChIKey | GQOCGJQXYVRFGG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|