C11H13ClINO4S — CID 54281706
2-oxopropyl (2S,5R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 54281706) has the molecular formula C11H13ClINO4S and a molecular weight of 417.65 g/mol. Its IUPAC name is 2-oxopropyl (2S,5R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2-oxopropyl (2S,5R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 54281706 |
| Molecular Formula | C11H13ClINO4S |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | 2-oxopropyl (2S,5R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)COC(=O)[C@@H]1N2C(=O)C(Cl)(I)[C@H]2SC1(C)C |
| InChI | InChI=1S/C11H13ClINO4S/c1-5(15)4-18-7(16)6-10(2,3)19-9-11(12,13)8(17)14(6)9/h6,9H,4H2,1-3H3/t6-,9+,11?/m0/s1 |
| InChIKey | RRFONDZOQRHITR-NOZFUZGUSA-N |
| XLogP | 1.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|