C9H10Cl2INO3S — CID 70394960
chloromethyl (2S,5R,6R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70394960) has the molecular formula C9H10Cl2INO3S and a molecular weight of 410.06 g/mol. Its IUPAC name is chloromethyl (2S,5R,6R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | chloromethyl (2S,5R,6R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70394960 |
| Molecular Formula | C9H10Cl2INO3S |
| Molecular Weight | 410.06 g/mol |
| Exact Mass | 408.88 |
| IUPAC Name | chloromethyl (2S,5R,6R)-6-chloro-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@H]2N(C(=O)[C@@]2(Cl)I)[C@H]1C(=O)OCCl |
| InChI | InChI=1S/C9H10Cl2INO3S/c1-8(2)4(5(14)16-3-10)13-6(15)9(11,12)7(13)17-8/h4,7H,3H2,1-2H3/t4-,7+,9+/m0/s1 |
| InChIKey | GIDKBNUNBKWIKB-ZJKWWJTRSA-N |
| XLogP | 2.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.06 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|