C9H10ClN3O3S — CID 88737393
chloromethyl (2S,5R)-6-diazo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88737393) has the molecular formula C9H10ClN3O3S and a molecular weight of 275.72 g/mol. Its IUPAC name is chloromethyl (2S,5R)-6-diazo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | chloromethyl (2S,5R)-6-diazo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88737393 |
| Molecular Formula | C9H10ClN3O3S |
| Molecular Weight | 275.72 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | chloromethyl (2S,5R)-6-diazo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2C(=[N+]=[N-])C(=O)N2[C@H]1C(=O)OCCl |
| InChI | InChI=1S/C9H10ClN3O3S/c1-9(2)5(8(15)16-3-10)13-6(14)4(12-11)7(13)17-9/h5,7H,3H2,1-2H3/t5-,7+/m0/s1 |
| InChIKey | UGWZKZCLSWAJQU-CAHLUQPWSA-N |
| XLogP | 0.46 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.72 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|