C24H20N4O6 — CID 54283781
4-[4-[1-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]ethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid (PubChem CID 54283781) has the molecular formula C24H20N4O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is 4-[4-[1-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]ethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid.
| Compound Name | 4-[4-[1-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]ethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 54283781 |
| Molecular Formula | C24H20N4O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-[4-[1-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]ethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)C1=C(C)c1c(C)[nH]n(-c2ccc(C(=O)O)cc2)c1=O |
| InChI | InChI=1S/C24H20N4O6/c1-12(19-13(2)25-27(21(19)29)17-8-4-15(5-9-17)23(31)32)20-14(3)26-28(22(20)30)18-10-6-16(7-11-18)24(33)34/h4-11,25H,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | YITKZOXYYHLDQI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|