C12H9N2NaO4 — CID 59051004
sodium (Z)-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methanolate (PubChem CID 59051004) has the molecular formula C12H9N2NaO4 and a molecular weight of 268.20 g/mol. Its IUPAC name is sodium (Z)-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methanolate.
| Compound Name | sodium (Z)-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methanolate |
|---|---|
| PubChem CID | 59051004 |
| Molecular Formula | C12H9N2NaO4 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | sodium (Z)-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methanolate |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C\[O-].[Na+] |
| InChI | InChI=1S/C12H10N2O4.Na/c1-7-10(6-15)11(16)14(13-7)9-4-2-8(3-5-9)12(17)18;/h2-6,15H,1H3,(H,17,18);/q;+1/p-1/b10-6-; |
| InChIKey | DBDLELQLYNRTTD-OTUCAILMSA-M |
| XLogP | -2.64 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|