C29H26N4O6 — CID 163957379
4-[4-[5-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]-2,4-dimethylpenta-1,3-dienyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid (PubChem CID 163957379) has the molecular formula C29H26N4O6 and a molecular weight of 526.55 g/mol. Its IUPAC name is 4-[4-[5-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]-2,4-dimethylpenta-1,3-dienyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid.
| Compound Name | 4-[4-[5-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]-2,4-dimethylpenta-1,3-dienyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 163957379 |
| Molecular Formula | C29H26N4O6 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 4-[4-[5-[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]-2,4-dimethylpenta-1,3-dienyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
| SMILES | CC(=CC(C)=Cc1c(C)[nH]n(-c2ccc(C(=O)O)cc2)c1=O)C=C1C(=O)N(c2ccc(C(=O)O)cc2)N=C1C |
| InChI | InChI=1S/C29H26N4O6/c1-16(14-24-18(3)30-32(26(24)34)22-9-5-20(6-10-22)28(36)37)13-17(2)15-25-19(4)31-33(27(25)35)23-11-7-21(8-12-23)29(38)39/h5-15,30H,1-4H3,(H,36,37)(H,38,39) |
| InChIKey | WJWSBRYEUCBPSP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|