C16H15NO2S — CID 54287350
2-(4-formylphenyl)sulfanyl-N,N-dimethylbenzamide (PubChem CID 54287350) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(4-formylphenyl)sulfanyl-N,N-dimethylbenzamide.
| Compound Name | 2-(4-formylphenyl)sulfanyl-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 54287350 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(4-formylphenyl)sulfanyl-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1Sc1ccc(C=O)cc1 |
| InChI | InChI=1S/C16H15NO2S/c1-17(2)16(19)14-5-3-4-6-15(14)20-13-9-7-12(11-18)8-10-13/h3-11H,1-2H3 |
| InChIKey | RVBONHMFRXTLTI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|