C30H29N3O2S2 — CID 542877
3-ethyl-5-[2-(3-ethyl-6-methoxy-1,3-benzothiazol-2-ylidene)-1-phenylethylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 542877) has the molecular formula C30H29N3O2S2 and a molecular weight of 527.72 g/mol. Its IUPAC name is 3-ethyl-5-[2-(3-ethyl-6-methoxy-1,3-benzothiazol-2-ylidene)-1-phenylethylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-5-[2-(3-ethyl-6-methoxy-1,3-benzothiazol-2-ylidene)-1-phenylethylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 542877 |
| Molecular Formula | C30H29N3O2S2 |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 3-ethyl-5-[2-(3-ethyl-6-methoxy-1,3-benzothiazol-2-ylidene)-1-phenylethylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=C(C=C2Sc3cc(OC)ccc3N2CC)c2ccccc2)S/C1=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C30H29N3O2S2/c1-5-32-25-17-16-23(35-4)18-26(25)36-27(32)19-24(21-10-8-7-9-11-21)28-29(34)33(6-2)30(37-28)31-22-14-12-20(3)13-15-22/h7-19H,5-6H2,1-4H3/b27-19?,28-24?,31-30+ |
| InChIKey | MQLSBFZZFVJDOI-OKCFKWBUSA-N |
| XLogP | 7.47 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|