C28H31NO — CID 54287842
1-(4-tert-butylphenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine (PubChem CID 54287842) has the molecular formula C28H31NO and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine.
| Compound Name | 1-(4-tert-butylphenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
|---|---|
| PubChem CID | 54287842 |
| Molecular Formula | C28H31NO |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
| SMILES | Cc1c(CONC(=C2CC2)c2ccc(C(C)(C)C)cc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C28H31NO/c1-20-24(11-8-12-26(20)21-9-6-5-7-10-21)19-30-29-27(22-13-14-22)23-15-17-25(18-16-23)28(2,3)4/h5-12,15-18,29H,13-14,19H2,1-4H3 |
| InChIKey | RVKNUKNIVDFUQB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|