C18H23N2O6+ — CID 54287953
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1-(phenylmethoxymethyl)pyrimidin-1-ium-2,4-dione (PubChem CID 54287953) has the molecular formula C18H23N2O6+ and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1-(phenylmethoxymethyl)pyrimidin-1-ium-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1-(phenylmethoxymethyl)pyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 54287953 |
| Molecular Formula | C18H23N2O6+ |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1-(phenylmethoxymethyl)pyrimidin-1-ium-2,4-dione |
| SMILES | CC1=C[N+](COCc2ccccc2)([C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)NC1=O |
| InChI | InChI=1S/C18H22N2O6/c1-12-8-20(18(24)19-17(12)23,16-7-14(22)15(9-21)26-16)11-25-10-13-5-3-2-4-6-13/h2-6,8,14-16,21-22H,7,9-11H2,1H3/p+1/t14-,15+,16+,20?/m0/s1 |
| InChIKey | PXGXVBIDECNPTQ-VZSIPSJESA-O |
| XLogP | 0.60 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|