C22H34N4O3S — CID 54288906
2-(diethylamino)-5-[1-hydroxy-2-[1-(N-methylanilino)propan-2-ylamino]ethyl]benzenesulfonamide (PubChem CID 54288906) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is 2-(diethylamino)-5-[1-hydroxy-2-[1-(N-methylanilino)propan-2-ylamino]ethyl]benzenesulfonamide.
| Compound Name | 2-(diethylamino)-5-[1-hydroxy-2-[1-(N-methylanilino)propan-2-ylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54288906 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-(diethylamino)-5-[1-hydroxy-2-[1-(N-methylanilino)propan-2-ylamino]ethyl]benzenesulfonamide |
| SMILES | CCN(CC)c1ccc(C(O)CNC(C)CN(C)c2ccccc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C22H34N4O3S/c1-5-26(6-2)20-13-12-18(14-22(20)30(23,28)29)21(27)15-24-17(3)16-25(4)19-10-8-7-9-11-19/h7-14,17,21,24,27H,5-6,15-16H2,1-4H3,(H2,23,28,29) |
| InChIKey | RWCOZLRAPHHLRU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|