C20H21F6N3O3S — CID 56932674
2-[4-[(2S)-4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 56932674) has the molecular formula C20H21F6N3O3S and a molecular weight of 497.46 g/mol. Its IUPAC name is 2-[4-[(2S)-4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 56932674 |
| Molecular Formula | C20H21F6N3O3S |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[4-[(2S)-4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccccc2N)CCN1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F6N3O3S/c1-13-12-28(33(31,32)17-5-3-2-4-16(17)27)10-11-29(13)15-8-6-14(7-9-15)18(30,19(21,22)23)20(24,25)26/h2-9,13,30H,10-12,27H2,1H3/t13-/m0/s1 |
| InChIKey | YMLIKWUGHQAVNU-ZDUSSCGKSA-N |
| XLogP | 3.48 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|