C16H22ClN3O — CID 54291308
2-(3-tert-butyl-1,2,4-triazol-1-yl)-4-(4-chlorophenyl)butan-2-ol (PubChem CID 54291308) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-(3-tert-butyl-1,2,4-triazol-1-yl)-4-(4-chlorophenyl)butan-2-ol.
| Compound Name | 2-(3-tert-butyl-1,2,4-triazol-1-yl)-4-(4-chlorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 54291308 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-(3-tert-butyl-1,2,4-triazol-1-yl)-4-(4-chlorophenyl)butan-2-ol |
| SMILES | CC(C)(C)c1ncn(C(C)(O)CCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H22ClN3O/c1-15(2,3)14-18-11-20(19-14)16(4,21)10-9-12-5-7-13(17)8-6-12/h5-8,11,21H,9-10H2,1-4H3 |
| InChIKey | RXRWIRCKEPGHPE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |