C16H24N4O5S — CID 54292591
2-amino-5-(2-methylpropylsulfamoyl)-4-(piperazine-1-carbonyl)benzoic acid (PubChem CID 54292591) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-amino-5-(2-methylpropylsulfamoyl)-4-(piperazine-1-carbonyl)benzoic acid.
| Compound Name | 2-amino-5-(2-methylpropylsulfamoyl)-4-(piperazine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 54292591 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-amino-5-(2-methylpropylsulfamoyl)-4-(piperazine-1-carbonyl)benzoic acid |
| SMILES | CC(C)CNS(=O)(=O)c1cc(C(=O)O)c(N)cc1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C16H24N4O5S/c1-10(2)9-19-26(24,25)14-8-11(16(22)23)13(17)7-12(14)15(21)20-5-3-18-4-6-20/h7-8,10,18-19H,3-6,9,17H2,1-2H3,(H,22,23) |
| InChIKey | RYOGKVYZMIYZRF-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|