C15H27N — CID 54292695
2,5-dimethylhexa-2,4-diene;N-(2-methylprop-1-enyl)propan-2-imine (PubChem CID 54292695) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2,5-dimethylhexa-2,4-diene;N-(2-methylprop-1-enyl)propan-2-imine.
| Compound Name | 2,5-dimethylhexa-2,4-diene;N-(2-methylprop-1-enyl)propan-2-imine |
|---|---|
| PubChem CID | 54292695 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2,5-dimethylhexa-2,4-diene;N-(2-methylprop-1-enyl)propan-2-imine |
| SMILES | CC(C)=CC=C(C)C.CC(C)=CN=C(C)C |
| InChI | InChI=1S/C8H14.C7H13N/c1-7(2)5-6-8(3)4;1-6(2)5-8-7(3)4/h5-6H,1-4H3;5H,1-4H3 |
| InChIKey | RYPWTOVEFITKGQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|